Difference between revisions of "CPD-35"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Long-Chain-Aldehydes Long-Chain-Aldehydes] == * common name: ** a long-chain aldehyde * Synonym...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] == * smiles: ** CC(=O)NCCCC(=O)[O-] * common name: ** 4-acetamidobutanoate * inc...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-35 CPD-35] == |
| + | * smiles: | ||
| + | ** CC(=O)NCCCC(=O)[O-] | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-acetamidobutanoate |
| + | * inchi key: | ||
| + | ** InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M | ||
| + | * molecular weight: | ||
| + | ** 144.15 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** N-acetyl-4-aminobutyrate |
| + | ** N-acetyl-γ-aminobutyrate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-37]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6991994 6991994] |
| − | {{#set: | + | * HMDB : HMDB03681 |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C02946 C02946] | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.5360158.html 5360158] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=11951 11951] | ||
| + | * METABOLIGHTS : MTBLC11951 | ||
| + | {{#set: smiles=CC(=O)NCCCC(=O)[O-]}} | ||
| + | {{#set: common name=4-acetamidobutanoate}} | ||
| + | {{#set: inchi key=InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M}} | ||
| + | {{#set: molecular weight=144.15 }} | ||
| + | {{#set: common name=N-acetyl-4-aminobutyrate|N-acetyl-γ-aminobutyrate}} | ||
| + | {{#set: produced by=RXN-37}} | ||
Latest revision as of 20:05, 21 March 2018
Contents
Metabolite CPD-35
- smiles:
- CC(=O)NCCCC(=O)[O-]
- common name:
- 4-acetamidobutanoate
- inchi key:
- InChIKey=UZTFMUBKZQVKLK-UHFFFAOYSA-M
- molecular weight:
- 144.15
- Synonym(s):
- N-acetyl-4-aminobutyrate
- N-acetyl-γ-aminobutyrate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- HMDB : HMDB03681
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC11951
"CC(=O)NCCCC(=O)[O-" cannot be used as a page name in this wiki.
