Difference between revisions of "2-ALPHA-HYDROXYETHYL-THPP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15654 CPD-15654] == * smiles: ** CCCCCCC=CC=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == * smiles: ** CC2(=C(SC(C(C)O)=[N+](CC1(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-ALPHA-HYDROXYETHYL-THPP 2-ALPHA-HYDROXYETHYL-THPP] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-]) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** 2- | + | ** 2-(α-hydroxyethyl)thiamine diphosphate |
+ | * inchi key: | ||
+ | ** InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 466.341 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2-(α-hydroxyethyl)-TPP |
+ | ** 2-(α-hydroxyethyl)-ThPP | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12508]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN-12583]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-14037]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878487 46878487] |
− | {{#set: smiles= | + | * CHEBI: |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58939 58939] |
− | {{#set: common name=2- | + | {{#set: smiles=CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])}} |
− | {{#set: | + | {{#set: common name=2-(α-hydroxyethyl)thiamine diphosphate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L}} |
− | {{#set: | + | {{#set: molecular weight=466.341 }} |
+ | {{#set: common name=2-(α-hydroxyethyl)-TPP|2-(α-hydroxyethyl)-ThPP}} | ||
+ | {{#set: consumed by=RXN-12508}} | ||
+ | {{#set: produced by=RXN-12583}} | ||
+ | {{#set: reversible reaction associated=RXN-14037}} |
Latest revision as of 20:05, 21 March 2018
Contents
Metabolite 2-ALPHA-HYDROXYETHYL-THPP
- smiles:
- CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])
- common name:
- 2-(α-hydroxyethyl)thiamine diphosphate
- inchi key:
- InChIKey=RRUVJGASJONMDY-UHFFFAOYSA-L
- molecular weight:
- 466.341
- Synonym(s):
- 2-(α-hydroxyethyl)-TPP
- 2-(α-hydroxyethyl)-ThPP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC2(=C(SC(C(C)O)=[N+](CC1(C=NC(C)=NC(N)=1))2)CCOP(=O)([O-])OP(=O)([O-])[O-])" cannot be used as a page name in this wiki.