Difference between revisions of "Tiso gene 10221"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] == * smiles:...")
(Created page with "Category:Gene == Gene Tiso_gene_10221 == * right end position: ** 8645 * transcription direction: ** POSITIVE * left end position: ** 6483 * centisome position: ** 74.4829...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET 2-PHOSPHO-4-CYTIDINE-5-DIPHOSPHO-2-C-MET] ==
+
== Gene Tiso_gene_10221 ==
−
* smiles:
+
* right end position:
−
** CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O
+
** 8645
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol
+
** 6483
−
* molecular weight:
+
* centisome position:
−
** 597.259    
+
** 74.482994    
 
* Synonym(s):
 
* Synonym(s):
−
** CDP-ME-2P
 
−
** CDP-methyl-D-erylthritol 2-phosphate
 
−
** 4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate
 
−
** 4-diphosphocytidyl-2-C-methylerythritol 2-phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-302]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[2.7.1.148-RXN]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
* Reaction: [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12195]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-12196]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN0-5462]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7184]]
 +
* [[PWY-7198]]
 +
* [[PWY-6545]]
 +
* [[PWY-7210]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=8645}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878430 46878430]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=6483}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57919 57919]
+
{{#set: centisome position=74.482994   }}
−
* BIGG : 2p4c2me
+
{{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11436 C11436]
+
−
{{#set: smiles=CC(OP([O-])([O-])=O)(CO)C(O)COP(OP([O-])(=O)OCC2(C(C(O)C(N1(C(N=C(C=C1)N)=O))O2)O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=HTJXTKBIUVFUAR-XHIBXCGHSA-J}}
+
−
{{#set: common name=2-phospho-4-(cytidine 5'-diphospho)-2-C-methyl-D-erythritol}}
+
−
{{#set: molecular weight=597.259   }}
+
−
{{#set: common name=CDP-ME-2P|CDP-methyl-D-erylthritol 2-phosphate|4-diphosphocytidyl-2C-methyl-D-erythritol 2-phosphate|4-diphosphocytidyl-2-C-methylerythritol 2-phosphate}}
+
−
{{#set: consumed by=RXN0-302}}
+
−
{{#set: produced by=2.7.1.148-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Gene Tiso_gene_10221

  • right end position:
    • 8645
  • transcription direction:
    • POSITIVE
  • left end position:
    • 6483
  • centisome position:
    • 74.482994
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_10221&oldid=45925"