Difference between revisions of "CPD-15435"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_514 == * left end position: ** 23226 * transcription direction: ** POSITIVE * right end position: ** 25085 * centisome position: ** 71.3921...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == |
− | * | + | * smiles: |
− | ** | + | ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O |
− | * | + | * common name: |
− | ** | + | ** L-threonylcarbamoyladenylate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 490.322 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[RXN-14570]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | + | * PUBCHEM: | |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682] |
− | {{#set: | + | {{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}} |
− | {{#set: | + | {{#set: common name=L-threonylcarbamoyladenylate}} |
+ | {{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}} | ||
+ | {{#set: molecular weight=490.322 }} | ||
+ | {{#set: consumed by=RXN-14570}} |
Latest revision as of 21:06, 21 March 2018
Contents
Metabolite CPD-15435
- smiles:
- CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
- common name:
- L-threonylcarbamoyladenylate
- inchi key:
- InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
- molecular weight:
- 490.322
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O" cannot be used as a page name in this wiki.