Difference between revisions of "Charged-ALA-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] == * smiles: ** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ALA-tRNAs Charged-ALA-tRNAs] == * common name: ** an L-alanyl-[tRNAala] * Synonym(s):...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15435 CPD-15435] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-ALA-tRNAs Charged-ALA-tRNAs] ==
* smiles:
+
** CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O
+
* inchi key:
+
** InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L
+
 
* common name:
 
* common name:
** L-threonylcarbamoyladenylate
+
** an L-alanyl-[tRNAala]
* molecular weight:
+
** 490.322   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[RXN-14570]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[ALANINE--TRNA-LIGASE-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=an L-alanyl-[tRNAala]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71464565 71464565]
+
{{#set: produced by=ALANINE--TRNA-LIGASE-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73682 73682]
+
{{#set: smiles=CC(O)C(C([O-])=O)NC(=O)OP(OCC3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))([O-])=O}}
+
{{#set: inchi key=InChIKey=GHLUPQUHEIJRCU-DWVDDHQFSA-L}}
+
{{#set: common name=L-threonylcarbamoyladenylate}}
+
{{#set: molecular weight=490.322    }}
+
{{#set: consumed by=RXN-14570}}
+

Latest revision as of 20:06, 21 March 2018

Metabolite Charged-ALA-tRNAs

  • common name:
    • an L-alanyl-[tRNAala]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"an L-alanyl-[tRNAala" cannot be used as a page name in this wiki.