Difference between revisions of "RXN-14201"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] == * smiles: ** C(O)CC1(=CNC2(=C1C=C(O)C=C2)) * inchi key: ** InChIKey=KQR...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14201 RXN-14201] == * direction: ** LEFT-TO-RIGHT * common name: ** ORF * ec number: ** [http:/...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11671 CPD-11671] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14201 RXN-14201] ==
−
* smiles:
+
* direction:
−
** C(O)CC1(=CNC2(=C1C=C(O)C=C2))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 5-hydroxytryptophol
+
** ORF
−
* molecular weight:
+
* ec number:
−
** 177.202   
+
** [http://enzyme.expasy.org/EC/3.6.1.5 EC-3.6.1.5]
 
* Synonym(s):
 
* Synonym(s):
−
** hydroxytryptophol
 
−
** 5-hydroxyindole-3-ethanol
 
−
** 5-hydroxy-1H-indole-3-ethanol
 
−
** 1H-indole-3-ethanol, 5-hydroxy-
 
−
** indole-3-ethanol, 5-hydroxy-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-10784]]
+
* With identifiers:
−
* [[RXN-10782]]
+
** 1 [[GTP]][c] '''+''' 2 [[WATER]][c] '''=>''' 1 [[GMP]][c] '''+''' 2 [[PROTON]][c] '''+''' 2 [[Pi]][c]
−
== Reaction(s) known to produce the compound ==
+
* With common name(s):
−
* [[RXN-10781]]
+
** 1 GTP[c] '''+''' 2 H2O[c] '''=>''' 1 GMP[c] '''+''' 2 H+[c] '''+''' 2 phosphate[c]
−
== Reaction(s) of unknown directionality ==
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_12899]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_20236]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9061 9061]
+
{{#set: common name=ORF}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-3.6.1.5}}
−
** [http://www.chemspider.com/Chemical-Structure.8708.html 8708]
+
{{#set: gene associated=Tiso_gene_12899|Tiso_gene_20236}}
−
* HMDB : HMDB01855
+
{{#set: in pathway=}}
−
{{#set: smiles=C(O)CC1(=CNC2(=C1C=C(O)C=C2))}}
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
{{#set: inchi key=InChIKey=KQROHCSYOGBQGJ-UHFFFAOYSA-N}}
+
{{#set: reconstruction source=annotation-experimental_annotation|manual-primary_network|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: common name=5-hydroxytryptophol}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: molecular weight=177.202    }}
+
−
{{#set: common name=hydroxytryptophol|5-hydroxyindole-3-ethanol|5-hydroxy-1H-indole-3-ethanol|1H-indole-3-ethanol, 5-hydroxy-|indole-3-ethanol, 5-hydroxy-}}
+
−
{{#set: consumed by=RXN-10784|RXN-10782}}
+
−
{{#set: produced by=RXN-10781}}
+

Latest revision as of 20:06, 21 March 2018

Reaction RXN-14201

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 GTP[c] + 2 H2O[c] => 1 GMP[c] + 2 H+[c] + 2 phosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14201&oldid=45952"