Difference between revisions of "Tiso gene 7235"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-31 CPD-31] == * smiles: ** CC(O)(C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=XFTRTWQBIOMV...") |
(Created page with "Category:Gene == Gene Tiso_gene_7235 == * Synonym(s): == Reactions associated == * Reaction: 1.10.2.2-RXN ** Source: orthology-esiliculosus * Reaction: RXN-1410...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_7235 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.10.2.2-RXN]] | |
− | * [[RXN- | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Reaction: [[RXN-14107]] |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-15816]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-15829]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-3781]] | ||
+ | * [[PWY-6692]] | ||
+ | * [[PWY-7279]] | ||
+ | * [[PWY-7082]] | ||
== External links == | == External links == | ||
− | + | {{#set: reaction associated=1.10.2.2-RXN|RXN-14107|RXN-15816|RXN-15829}} | |
− | + | {{#set: pathway associated=PWY-3781|PWY-6692|PWY-7279|PWY-7082}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + |
Latest revision as of 20:06, 21 March 2018
Gene Tiso_gene_7235
- Synonym(s):
Reactions associated
- Reaction: 1.10.2.2-RXN
- Source: orthology-esiliculosus
- Reaction: RXN-14107
- Source: orthology-esiliculosus
- Reaction: RXN-15816
- Source: orthology-esiliculosus
- Reaction: RXN-15829
- Source: orthology-esiliculosus