Difference between revisions of "Tiso gene 14709"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
 
(Created page with "Category:Gene == Gene Tiso_gene_14709 == * right end position: ** 5413 * transcription direction: ** NEGATIVE * left end position: ** 3254 * centisome position: ** 59.4229...")
 
(4 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11524 CPD-11524] ==
+
== Gene Tiso_gene_14709 ==
−
* smiles:
+
* right end position:
−
** CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 5413
−
* inchi key:
+
* transcription direction:
−
** InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** OPC6-3-ketoacyl-CoA
+
** 3254
−
* molecular weight:
+
* centisome position:
−
** 1025.85    
+
** 59.422935    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10700]]
+
* Reaction: [[OHMETHYLBILANESYN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-10702]]
+
*** Assignment: ec-number
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY-5189]]
 +
* [[PWY-5188]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=5413}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237277 44237277]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: left end position=3254}}
−
{{#set: inchi key=InChIKey=ADGIRVMSHGGGHU-JYNUABGASA-J}}
+
{{#set: centisome position=59.422935   }}
−
{{#set: common name=OPC6-3-ketoacyl-CoA}}
+
{{#set: reaction associated=OHMETHYLBILANESYN-RXN}}
−
{{#set: molecular weight=1025.85   }}
+
{{#set: pathway associated=PWY-5189|PWY-5188}}
−
{{#set: consumed by=RXN-10700}}
+
−
{{#set: produced by=RXN-10702}}
+

Latest revision as of 19:29, 21 March 2018

Gene Tiso_gene_14709

  • right end position:
    • 5413
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 3254
  • centisome position:
    • 59.422935
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_14709&oldid=41954"