Difference between revisions of "TMDPT"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] == * smiles: ** C([O-])(=O)CCCNC(=[N+])N * inchi key: ** InChIKey=TUHVEAJXIMEO...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=TMDPT TMDPT] == * direction: ** LEFT-TO-RIGHT * common name: ** ATP:thiamine diphosphotransferase *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-592 CPD-592] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=TMDPT TMDPT] ==
−
* smiles:
+
* direction:
−
** C([O-])(=O)CCCNC(=[N+])N
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N
+
 
* common name:
 
* common name:
−
** 4-guanidinobutanoate
+
** ATP:thiamine diphosphotransferase
−
* molecular weight:
+
−
** 145.161   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 4-guanido-butyrate
 
−
** γ-guanidinobutyrate
 
−
** 4-guanidinobutyrate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GUANIDINOBUTYRASE-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[THIAMINE]][c] '''+''' 1.0 [[ATP]][c] '''=>''' 1.0 [[AMP]][c] '''+''' 1.0 [[THIAMINE-PYROPHOSPHATE]][c] '''+''' 1.0 [[PROTON]][c]
−
* [[GUANIDINOBUTANAMIDE-NH3-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1.0 thiamine[c] '''+''' 1.0 ATP[c] '''=>''' 1.0 AMP[c] '''+''' 1.0 thiamine diphosphate[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_16512]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_1453]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01035 C01035]
+
{{#set: common name=ATP:thiamine diphosphotransferase}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_16512|Tiso_gene_1453}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57486 57486]
+
{{#set: in pathway=}}
−
* METABOLIGHTS : MTBLC57486
+
{{#set: reconstruction category=orthology}}
−
* PUBCHEM:
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200642 25200642]
+
{{#set: reconstruction tool=pantograph}}
−
* HMDB : HMDB03464
+
−
{{#set: smiles=C([O-])(=O)CCCNC(=[N+])N}}
+
−
{{#set: inchi key=InChIKey=TUHVEAJXIMEOSA-UHFFFAOYSA-N}}
+
−
{{#set: common name=4-guanidinobutanoate}}
+
−
{{#set: molecular weight=145.161    }}
+
−
{{#set: common name=4-guanido-butyrate|γ-guanidinobutyrate|4-guanidinobutyrate}}
+
−
{{#set: consumed by=GUANIDINOBUTYRASE-RXN}}
+
−
{{#set: produced by=GUANIDINOBUTANAMIDE-NH3-RXN}}
+

Latest revision as of 20:06, 21 March 2018

Reaction TMDPT

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • ATP:thiamine diphosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 thiamine[c] + 1.0 ATP[c] => 1.0 AMP[c] + 1.0 thiamine diphosphate[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TMDPT&oldid=46025"