Difference between revisions of "CPD-19179"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GGPS GGPS] == * direction: ** LEFT-TO-RIGHT * common name: ** geranylgeranyl diphosphate synthase *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4)))) |
* common name: | * common name: | ||
| − | ** | + | ** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate |
| + | * inchi key: | ||
| + | ** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J | ||
| + | * molecular weight: | ||
| + | ** 519.151 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 3',8-cH2GTP | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-8340]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}} |
| − | {{#set: common name= | + | {{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}} |
| − | + | {{#set: molecular weight=519.151 }} | |
| − | {{#set: | + | {{#set: common name=3',8-cH2GTP}} |
| − | {{#set: | + | {{#set: produced by=RXN-8340}} |
| − | {{#set: | + | |
Latest revision as of 20:07, 21 March 2018
Contents
Metabolite CPD-19179
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
- common name:
- (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
- inchi key:
- InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
- molecular weight:
- 519.151
- Synonym(s):
- 3',8-cH2GTP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))" cannot be used as a page name in this wiki.
