Difference between revisions of "R01655"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-414 CPD-414] == * smiles: ** CC(NC1(C(CC(OC1C(O)C(O)CO)(C([O-])=O)O)OC(C)=O))=O * inchi key...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01655 R01655] == * direction: ** REVERSIBLE * common name: ** R145 * Synonym(s): == Reaction Form...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01655 R01655] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** R145 |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1.0 [[WATER]][c] '''+''' 1.0 [[5-10-METHENYL-THF]][c] '''<=>''' 1.0 [[10-FORMYL-THF]][c] '''+''' 1.0 [[PROTON]][c] |
| − | == | + | * With common name(s): |
| + | ** 1.0 H2O[c] '''+''' 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] '''<=>''' 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] '''+''' 1.0 H+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_432]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-synechocystis]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | + | {{#set: common name=R145}} | |
| − | + | {{#set: gene associated=Tiso_gene_432}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology}} | |
| − | + | {{#set: reconstruction source=orthology-synechocystis}} | |
| − | + | {{#set: reconstruction tool=pantograph}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 21:07, 21 March 2018
Contents
Reaction R01655
- direction:
- REVERSIBLE
- common name:
- R145
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 WATER[c] + 1.0 5-10-METHENYL-THF[c] <=> 1.0 10-FORMYL-THF[c] + 1.0 PROTON[c]
- With common name(s):
- 1.0 H2O[c] + 1.0 5,10-methenyltetrahydrofolate mono-L-glutamate[c] <=> 1.0 10-formyl-tetrahydrofolate mono-L-glutamate[c] + 1.0 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_432
- Source: orthology-synechocystis
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-synechocystis
