Difference between revisions of "Histone-L-lysine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-lysine Histone-L-lysine] == * common name: ** a [histone]-L-lysine * Synonym(s): ** h...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19179 CPD-19179] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-L-lysine Histone-L-lysine] ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))
+
* inchi key:
+
** InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J
+
 
* common name:
 
* common name:
** (8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate
+
** a [histone]-L-lysine
* molecular weight:
+
** 519.151   
+
 
* Synonym(s):
 
* Synonym(s):
** 3',8-cH2GTP
+
** histone-L-lysine
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-8340]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[3.5.1.98-RXN]]
 +
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
== External links  ==
 
== External links  ==
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OP(=O)([O-])[O-])C3(OC2(N1(C4(N=C(N)NC(=O)C(N[CH]1C(O)(C(O)2)3)=4))))}}
+
{{#set: common name=a [histone]-L-lysine}}
{{#set: inchi key=InChIKey=HRBCPXBJAWPPIC-GZBYGQQWSA-J}}
+
{{#set: common name=histone-L-lysine}}
{{#set: common name=(8S)-3',8-cyclo-7,8-dihydroguanosine 5'-triphosphate}}
+
{{#set: consumed by=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN}}
{{#set: molecular weight=519.151    }}
+
{{#set: reversible reaction associated=3.5.1.98-RXN|HISTONE-ACETYLTRANSFERASE-RXN}}
{{#set: common name=3',8-cH2GTP}}
+
{{#set: produced by=RXN-8340}}
+

Latest revision as of 20:07, 21 March 2018

Metabolite Histone-L-lysine

  • common name:
    • a [histone]-L-lysine
  • Synonym(s):
    • histone-L-lysine

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a [histone]-L-lysine" cannot be used as a page name in this wiki.