Difference between revisions of "CPD-19491"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19293 == * Synonym(s): == Reactions associated == * GLYOXIII-RXN ** pantograph-esiliculosus == Pathways associated == == Exter...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == * smiles: ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] * common name: ** 3-isop...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19491 CPD-19491] == |
| + | * smiles: | ||
| + | ** C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-] | ||
| + | * common name: | ||
| + | ** 3-isopropyl-6-(methylthio)-2-oxohexanoate | ||
| + | * inchi key: | ||
| + | ** InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L | ||
| + | * molecular weight: | ||
| + | ** 218.224 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-18209]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| + | * [[RXN-18208]] | ||
== External links == | == External links == | ||
| − | {{#set: reaction associated= | + | {{#set: smiles=C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]}} |
| + | {{#set: common name=3-isopropyl-6-(methylthio)-2-oxohexanoate}} | ||
| + | {{#set: inchi key=InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=218.224 }} | ||
| + | {{#set: consumed by=RXN-18209}} | ||
| + | {{#set: reversible reaction associated=RXN-18208}} | ||
Latest revision as of 21:07, 21 March 2018
Contents
Metabolite CPD-19491
- smiles:
- C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-]
- common name:
- 3-isopropyl-6-(methylthio)-2-oxohexanoate
- inchi key:
- InChIKey=WRGKTDWHJSBCJR-UHFFFAOYSA-L
- molecular weight:
- 218.224
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CCCSC)C(=O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.
