Difference between revisions of "CPD-11410"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] == * common name: ** a [histone]-N6-acetyl-L-lysin...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Histone-Acetyl-Lysine Histone-Acetyl-Lysine] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
 +
* smiles:
 +
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
 
* common name:
 
* common name:
** a [histone]-N6-acetyl-L-lysine
+
** triiodothyroacetate ether glucuronide
 +
* inchi key:
 +
** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
 +
* molecular weight:
 +
** 796.046   
 
* Synonym(s):
 
* Synonym(s):
 +
** triiodothyroacetic acid ether glucuronide
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-10619]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[3.5.1.98-RXN]]
 
* [[HISTONE-ACETYLTRANSFERASE-RXN]]
 
 
== External links  ==
 
== External links  ==
{{#set: common name=a [histone]-N6-acetyl-L-lysine}}
+
* PUBCHEM:
{{#set: reversible reaction associated=3.5.1.98-RXN|HISTONE-ACETYLTRANSFERASE-RXN}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025]
 +
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}}
 +
{{#set: common name=triiodothyroacetate ether glucuronide}}
 +
{{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}}
 +
{{#set: molecular weight=796.046    }}
 +
{{#set: common name=triiodothyroacetic acid ether glucuronide}}
 +
{{#set: produced by=RXN-10619}}

Latest revision as of 20:08, 21 March 2018

Metabolite CPD-11410

  • smiles:
    • C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
  • common name:
    • triiodothyroacetate ether glucuronide
  • inchi key:
    • InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
  • molecular weight:
    • 796.046
  • Synonym(s):
    • triiodothyroacetic acid ether glucuronide

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))" cannot be used as a page name in this wiki.