Difference between revisions of "METBALT-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=METBALT-RXN METBALT-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11410 CPD-11410] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=METBALT-RXN METBALT-RXN] ==
* smiles:
+
* direction:
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))
+
** LEFT-TO-RIGHT
* inchi key:
+
* ec number:
** InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L
+
** [http://enzyme.expasy.org/EC/4.3.1 EC-4.3.1]
* common name:
+
** triiodothyroacetate ether glucuronide
+
* molecular weight:
+
** 796.046   
+
 
* Synonym(s):
 
* Synonym(s):
** triiodothyroacetic acid ether glucuronide
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-10619]]
+
** 1 [[WATER]][c] '''+''' 1 [[O-SUCCINYL-L-HOMOSERINE]][c] '''=>''' 1 [[2-OXOBUTANOATE]][c] '''+''' 1 [[SUC]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[PROTON]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 H2O[c] '''+''' 1 O-succinyl-L-homoserine[c] '''=>''' 1 2-oxobutanoate[c] '''+''' 1 succinate[c] '''+''' 1 ammonium[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3732]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-RXN:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659025 90659025]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00999 R00999]
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC3(=CC(I)=C(OC2(OC(C([O-])=O)C(O)C(O)C(O)2))C=C3))}}
+
{{#set: direction=LEFT-TO-RIGHT}}
{{#set: inchi key=InChIKey=VXVBZMWOWMHXTQ-KFYUBCHVSA-L}}
+
{{#set: ec number=EC-4.3.1}}
{{#set: common name=triiodothyroacetate ether glucuronide}}
+
{{#set: gene associated=Tiso_gene_3732}}
{{#set: molecular weight=796.046    }}
+
{{#set: in pathway=}}
{{#set: common name=triiodothyroacetic acid ether glucuronide}}
+
{{#set: reconstruction category=orthology}}
{{#set: produced by=RXN-10619}}
+
{{#set: reconstruction source=orthology-athaliana|orthology-creinhardtii|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:08, 21 March 2018

Reaction METBALT-RXN

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links