Difference between revisions of "CPD-11740"

Latest revision as of 20:08, 21 March 2018

"C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
 [[Category:Metabolite]]
-== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Pre-tRNA-3-prime-half-molecules Pre-tRNA-3-prime-half-molecules] ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
+* smiles:
+** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
 * common name:
-** a 3'-half-tRNA molecule with a 5'-OH end
+** carboxyphosphinopyruvate
+* inchi key:
+** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
+* molecular weight:
+** 193.029
 * Synonym(s):
 == Reaction(s) known to consume the compound ==
+* [[RXN-10828]]
 == Reaction(s) known to produce the compound ==
-* [[3.1.27.9-RXN]]
+* [[RXN-10827]]
 == Reaction(s) of unknown directionality ==
 == External links  ==
-{{#set: common name=a 3'-half-tRNA molecule with a 5'-OH end}}
+* PUBCHEM:
-{{#set: produced by=3.1.27.9-RXN}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
+{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
+{{#set: common name=carboxyphosphinopyruvate}}
+{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
+{{#set: molecular weight=193.029    }}
+{{#set: consumed by=RXN-10828}}
+{{#set: produced by=RXN-10827}}