Difference between revisions of "CPDQT-29"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == * smiles: ** CSCCCCCCC(=O)C([O-])=O * common name: ** 8-(methylthio)-2-ox...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-29 CPDQT-29] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CSCCCCCCC(=O)C([O-])=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 8-(methylthio)-2-oxooctanoate |
| + | * inchi key: | ||
| + | ** InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 203.276 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 8-(methylthio)-2-oxooctanoic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-18205]] |
| + | * [[RXNQT-4171]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237313 44237313] |
| − | {{#set: smiles= | + | * KNAPSACK : C00007643 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=CSCCCCCCC(=O)C([O-])=O}} |
| − | + | {{#set: common name=8-(methylthio)-2-oxooctanoate}} | |
| − | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M}} |
| − | {{#set: | + | {{#set: molecular weight=203.276 }} |
| − | {{#set: produced by=RXN- | + | {{#set: common name=8-(methylthio)-2-oxooctanoic acid}} |
| + | {{#set: produced by=RXN-18205|RXNQT-4171}} | ||
Latest revision as of 20:08, 21 March 2018
Contents
Metabolite CPDQT-29
- smiles:
- CSCCCCCCC(=O)C([O-])=O
- common name:
- 8-(methylthio)-2-oxooctanoate
- inchi key:
- InChIKey=QDZNKMGEHAHOTA-UHFFFAOYSA-M
- molecular weight:
- 203.276
- Synonym(s):
- 8-(methylthio)-2-oxooctanoic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
- KNAPSACK : C00007643
"CSCCCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.
