Difference between revisions of "RXN6666-9"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] == * smiles: ** C(C5(OC(OC...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-9 RXN6666-9] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE LUTEOLIN-7-O-BETA-D-DIGLUCURONIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN6666-9 RXN6666-9] ==
−
* smiles:
+
* direction:
−
** C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L
+
** [http://enzyme.expasy.org/EC/2.8.2.1 EC-2.8.2.1]
−
* common name:
+
−
** luteolin 7-O-β-D-diglucuronide
+
−
* molecular weight:
+
−
** 636.476   
+
 
* Synonym(s):
 
* Synonym(s):
−
** luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-15288]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[DOPAMINE]][c] '''+''' 1 [[PAPS]][c] '''=>''' 1 [[CPD-7649]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[3-5-ADP]][c]
−
* [[RXN-15289]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 dopamine[c] '''+''' 1 3'-phosphoadenylyl-sulfate[c] '''=>''' 1 dopamine 3-O-sulfate[c] '''+''' 1 H+[c] '''+''' 1 adenosine 3',5'-bisphosphate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5505]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY6666-2]], dopamine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY6666-2 PWY6666-2]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878427 46878427]
+
{{#set: ec number=EC-2.8.2.1}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_5505}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57815 57815]
+
{{#set: in pathway=PWY6666-2}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C12632 C12632]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* HMDB : HMDB60297
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=C(C5(OC(OC1(C(C(C(C([O-])=O)OC1OC4(C=C3(C(C(C=C(C2(=CC=C(C(=C2)O)O))O3)=O)=C(C=4)O)))O)O))C(C(C5O)O)O))([O-])=O}}
+
−
{{#set: inchi key=InChIKey=PBBVWJQPAZYQDB-DBFWEQBMSA-L}}
+
−
{{#set: common name=luteolin 7-O-β-D-diglucuronide}}
+
−
{{#set: molecular weight=636.476    }}
+
−
{{#set: common name=luteolin 7-O-[β-D-glucosyluronate-(1->2)-β-D-glucuronide]}}
+
−
{{#set: consumed by=RXN-15288}}
+
−
{{#set: produced by=RXN-15289}}
+

Latest revision as of 19:06, 21 March 2018

Reaction RXN6666-9

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dopamine[c] + 1 3'-phosphoadenylyl-sulfate[c] => 1 dopamine 3-O-sulfate[c] + 1 H+[c] + 1 adenosine 3',5'-bisphosphate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY6666-2, dopamine degradation: PWY6666-2
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN6666-9&oldid=39532"