Difference between revisions of "RXN-8026"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8026 RXN-8026] == * direction: ** LEFT-TO-RIGHT * Synonym(s): ** CrtZ == Reaction Formula == *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-8026 RXN-8026] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])([O-])=O)C([N+])C([O-])=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L
+
−
* common name:
+
−
** 3-phospho-L-serine
+
−
* molecular weight:
+
−
** 183.057   
+
 
* Synonym(s):
 
* Synonym(s):
−
** O-phospho-L-serine
+
** CrtZ
−
** L-serine phosphate
+
−
** phosphoryl-L-serine
+
−
** L-seryl phosphate
+
−
** L-serine-3P
+
−
** L-serine 3-phosphate
+
−
** 3-phospho-L-serine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-5114]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[CPD-7409]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD1F-130]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[NAD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[PSERTRANSAM-RXN]]
+
** 1 oxygen[c] '''+''' 1 NADH[c] '''+''' 1 β-cryptoxanthin[c] '''+''' 1 H+[c] '''=>''' 1 zeaxanthin[c] '''+''' 1 H2O[c] '''+''' 1 NAD+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10837]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
* [[PWY-5288]], astaxanthin biosynthesis (bacteria, fungi, algae): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5288 PWY-5288]
 +
** '''2''' reactions found over '''10''' reactions in the full pathway
 +
* [[PWY-5944]], zeaxanthin biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5944 PWY-5944]
 +
** '''2''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY-7638]], echinenone and zeaxanthin biosynthesis (Synechocystis): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7638 PWY-7638]
 +
** '''2''' reactions found over '''4''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 407-41-0
+
* RHEA:
−
* CAS : 17885-08-4
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30330 30330]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059387 7059387]
+
** [http://www.genome.jp/dbget-bin/www_bget?R07559 R07559]
−
* HMDB : HMDB00272
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* LIGAND-CPD:
+
{{#set: common name=CrtZ}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01005 C01005]
+
{{#set: gene associated=Tiso_gene_10837}}
−
* CHEMSPIDER:
+
{{#set: in pathway=PWY-5288|PWY-5944|PWY-7638}}
−
** [http://www.chemspider.com/Chemical-Structure.5415612.html 5415612]
+
{{#set: reconstruction category=orthology}}
−
* CHEBI:
+
{{#set: reconstruction source=orthology-synechocystis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57524 57524]
+
{{#set: reconstruction tool=pantograph}}
−
* BIGG : pser__L
+
−
{{#set: smiles=C(OP([O-])([O-])=O)C([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L}}
+
−
{{#set: common name=3-phospho-L-serine}}
+
−
{{#set: molecular weight=183.057    }}
+
−
{{#set: common name=O-phospho-L-serine|L-serine phosphate|phosphoryl-L-serine|L-seryl phosphate|L-serine-3P|L-serine 3-phosphate|3-phospho-L-serine}}
+
−
{{#set: consumed by=RXN0-5114}}
+
−
{{#set: reversible reaction associated=PSERTRANSAM-RXN}}
+

Latest revision as of 20:08, 21 March 2018

Reaction RXN-8026

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):
    • CrtZ

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5288, astaxanthin biosynthesis (bacteria, fungi, algae): PWY-5288
    • 2 reactions found over 10 reactions in the full pathway
  • PWY-5944, zeaxanthin biosynthesis: PWY-5944
    • 2 reactions found over 2 reactions in the full pathway
  • PWY-7638, echinenone and zeaxanthin biosynthesis (Synechocystis): PWY-7638
    • 2 reactions found over 4 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-8026&oldid=46254"