Difference between revisions of "CPD-13375"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_13619 == * left end position: ** 1157 * transcription direction: ** NEGATIVE * right end position: ** 5112 * centisome position: ** 18.7156...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_13619 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] ==
* left end position:
+
* smiles:
** 1157
+
** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
* transcription direction:
+
* common name:
** NEGATIVE
+
** XXXG xyloglucan oligosaccharide
* right end position:
+
* inchi key:
** 5112
+
** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
* centisome position:
+
* molecular weight:
** 18.715626    
+
** 1062.931    
 
* Synonym(s):
 
* Synonym(s):
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[4.2.2.10-RXN]]
+
== Reaction(s) known to produce the compound ==
** [[pantograph]]-[[esiliculosus]]
+
* [[RXN-12400]]
* [[RXN-15556]]
+
* [[RXN-12399]]
** in-silico_annotation
+
* [[RXN-12398]]
***ec-number
+
== Reaction(s) of unknown directionality ==
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
+
** in-silico_annotation
+
***ec-number
+
== Pathways associated ==
+
* [[PWY-7511]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1157}}
+
* PUBCHEM:
{{#set: transcription direction=NEGATIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180]
{{#set: right end position=5112}}
+
{{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}}
{{#set: centisome position=18.715626   }}
+
{{#set: common name=XXXG xyloglucan oligosaccharide}}
{{#set: reaction associated=4.2.2.10-RXN|RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
+
{{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}}
{{#set: pathway associated=PWY-7511}}
+
{{#set: molecular weight=1062.931   }}
 +
{{#set: produced by=RXN-12400|RXN-12399|RXN-12398}}

Latest revision as of 20:09, 21 March 2018

Metabolite CPD-13375

  • smiles:
    • C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
  • common name:
    • XXXG xyloglucan oligosaccharide
  • inchi key:
    • InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
  • molecular weight:
    • 1062.931
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links