Difference between revisions of "CPD-13375"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_13619 == * left end position: ** 1157 * transcription direction: ** NEGATIVE * right end position: ** 5112 * centisome position: ** 18.7156...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == * smiles: ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13375 CPD-13375] == |
− | * | + | * smiles: |
− | ** | + | ** C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O) |
− | * | + | * common name: |
− | ** | + | ** XXXG xyloglucan oligosaccharide |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N |
− | * | + | * molecular weight: |
− | ** | + | ** 1062.931 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN-12400]] | |
− | * [[RXN- | + | * [[RXN-12399]] |
− | + | * [[RXN-12398]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940180 52940180] |
− | {{#set: | + | {{#set: smiles=C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)}} |
− | {{#set: | + | {{#set: common name=XXXG xyloglucan oligosaccharide}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N}} |
− | + | {{#set: molecular weight=1062.931 }} | |
+ | {{#set: produced by=RXN-12400|RXN-12399|RXN-12398}} |
Latest revision as of 21:09, 21 March 2018
Contents
Metabolite CPD-13375
- smiles:
- C1(C(C(C(C(O1)OCC2(OC(C(O)C(O)C(O)2)OC4(C(O)C(O)C(OC(COC3(C(C(C(CO3)O)O)O))4)OC6(C(O)C(O)C(OC(COC5(C(C(C(CO5)O)O)O))6)OC7(C(O)C(O)C(O)OC(CO)7)))))O)O)O)
- common name:
- XXXG xyloglucan oligosaccharide
- inchi key:
- InChIKey=PZUPAGRIHCRVKN-SPHBQONKSA-N
- molecular weight:
- 1062.931
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM: