Difference between revisions of "Tiso gene 358"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LINAMARIN LINAMARIN] == * smiles: ** CC(C)(C#N)OC1(OC(CO)C(O)C(O)C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Gene == Gene Tiso_gene_358 == * Synonym(s): == Reactions associated == * Reaction: NADH-DEHYDROG-A-RXN ** Source: annotation-in-silico_annotation *** Ass...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_358 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[NADH-DEHYDROG-A-RXN]] |
| − | == | + | ** Source: [[annotation-in-silico_annotation]] |
| − | * [[ | + | *** Assignment: ec-number |
| − | + | == Pathways associated == | |
| + | * [[PWY-6692]] | ||
| + | * [[PWY-3781]] | ||
| + | * [[PWY-5083]] | ||
| + | * [[PWY0-1334]] | ||
| + | * [[PWY0-1335]] | ||
| + | * [[PWY-4302]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=NADH-DEHYDROG-A-RXN}} | |
| − | + | {{#set: pathway associated=PWY-6692|PWY-3781|PWY-5083|PWY0-1334|PWY0-1335|PWY-4302}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 20:09, 21 March 2018
Gene Tiso_gene_358
- Synonym(s):
Reactions associated
- Reaction: NADH-DEHYDROG-A-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
