Difference between revisions of "RXN-9787"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] == * smiles: ** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] == * direction: ** REVERSIBLE * common name: ** cysteine:[ThiI sulfur-carrier pr...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7221 CPD-7221] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9787 RXN-9787] ==
* smiles:
+
* direction:
** CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O
+
** REVERSIBLE
* inchi key:
+
** InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J
+
 
* common name:
 
* common name:
** 3-cis-dodecenoyl-CoA
+
** cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
* molecular weight:
+
** cysteine_mitochondrial
** 943.792   
+
** cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.8.1.7 EC-2.8.1.7]
 
* Synonym(s):
 
* Synonym(s):
** 12:1(n-9)
 
** 12:1 cis-3
 
** cis-3-dodecenoyl-CoA
 
** (3Z)-dodecenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-14394]]
+
** 1 [[Sulfur-Carrier-Proteins-ThiI]][c] '''+''' 1 [[CYS]][c] '''<=>''' 1 [[Sulfurylated-ThiI]][c] '''+''' 1 [[L-ALPHA-ALANINE]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a ThiI sulfur-carrier protein[c] '''+''' 1 L-cysteine[c] '''<=>''' 1 an S-sulfanyl-[ThiI sulfur-carrier protein][c] '''+''' 1 L-alanine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_4284]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_11478]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_14710]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=REVERSIBLE}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659197 90659197]
+
{{#set: common name=cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase}}
* CHEBI:
+
{{#set: common name=cysteine_mitochondrial}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27989 27989]
+
{{#set: common name=cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf}}
* LIGAND-CPD:
+
{{#set: ec number=EC-2.8.1.7}}
** [http://www.genome.jp/dbget-bin/www_bget?C02944 C02944]
+
{{#set: gene associated=Tiso_gene_4284|Tiso_gene_11478|Tiso_gene_14710}}
* HMDB : HMDB04257
+
{{#set: in pathway=}}
{{#set: smiles=CCCCCCCCC=CCC(SCCNC(CCNC(C(C(COP(OP(OCC3(C(OP(=O)([O-])[O-])C(O)C(N2(C1(N=CN=C(N)C=1N=C2)))O3))(=O)[O-])(=O)[O-])(C)C)O)=O)=O)=O}}
+
{{#set: reconstruction category=orthology|annotation}}
{{#set: inchi key=InChIKey=XEMIVMKTVGRFTD-QXMHVHEDSA-J}}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}}
{{#set: common name=3-cis-dodecenoyl-CoA}}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
{{#set: molecular weight=943.792    }}
+
{{#set: common name=12:1(n-9)|12:1 cis-3|cis-3-dodecenoyl-CoA|(3Z)-dodecenoyl-CoA}}
+
{{#set: produced by=RXN-14394}}
+

Latest revision as of 20:09, 21 March 2018

Reaction RXN-9787

  • direction:
    • REVERSIBLE
  • common name:
    • cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase
    • cysteine_mitochondrial
    • cysteine_desulfurase_for_iron-sulfur_cluster_formation_suf
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

"cysteine:[ThiI sulfur-carrier protein]-L-cysteine sulfurtransferase desulfurase" cannot be used as a page name in this wiki.