Difference between revisions of "RX"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-BETA-D-RIBOSYL-AMINE 5-P-BETA-D-RIBOSYL-AMINE] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RX RX] == * smiles: ** [R]X * common name: ** RX * Synonym(s): == Reaction(s) known to consume...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-P-BETA-D-RIBOSYL-AMINE 5-P-BETA-D-RIBOSYL-AMINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RX RX] ==
 
* smiles:
 
* smiles:
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C([N+])O1)
+
** [R]X
* inchi key:
+
** InChIKey=SKCBPEVYGOQGJN-TXICZTDVSA-M
+
 
* common name:
 
* common name:
** 5-phospho-β-D-ribosylamine
+
** RX
* molecular weight:
+
** 228.118   
+
 
* Synonym(s):
 
* Synonym(s):
** 5-P-β-D-ribosylamine
 
** PRA
 
** 5-phosphoribosylamine
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[GLYRIBONUCSYN-RXN]]
+
* [[GSHTRAN-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[PRPPAMIDOTRANS-RXN]]
 
 
== External links  ==
 
== External links  ==
* BIGG : pram
+
{{#set: smiles=[R]X}}
* PUBCHEM:
+
{{#set: common name=RX}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266724 45266724]
+
{{#set: consumed by=GSHTRAN-RXN}}
* HMDB : HMDB01128
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C03090 C03090]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58681 58681]
+
* METABOLIGHTS : MTBLC58681
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C([N+])O1)}}
+
{{#set: inchi key=InChIKey=SKCBPEVYGOQGJN-TXICZTDVSA-M}}
+
{{#set: common name=5-phospho-β-D-ribosylamine}}
+
{{#set: molecular weight=228.118    }}
+
{{#set: common name=5-P-β-D-ribosylamine|PRA|5-phosphoribosylamine}}
+
{{#set: consumed by=GLYRIBONUCSYN-RXN}}
+
{{#set: reversible reaction associated=PRPPAMIDOTRANS-RXN}}
+

Latest revision as of 20:09, 21 March 2018

Metabolite RX

  • smiles:
    • [R]X
  • common name:
    • RX
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"R]X" cannot be used as a page name in this wiki.