Difference between revisions of "3.5.1.27-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.27-RXN 3.5.1.27-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** polypeptide_deformyla...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=3.5.1.27-RXN 3.5.1.27-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** polypeptide_deformylase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.1.88 EC-3.5.1.88] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[Charged-fMET-tRNAs]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[L-Methionylaminoacyl-tRNAs]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[FORMATE]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 an N-formyl-L-methionylaminoacyl-tRNA[c] '''+''' 1 H2O[c] '''=>''' 1 a L-methionylaminoacyl-tRNA[c] '''+''' 1 H+[c] '''+''' 1 formate[c] |
− | == | + | |
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14998]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04268 R04268] | |
− | + | * UNIPROT: | |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P44786 P44786] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A6K3 P0A6K3] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http://www. | + | {{#set: common name=polypeptide_deformylase}} |
− | + | {{#set: ec number=EC-3.5.1.88}} | |
− | ** [http://www. | + | {{#set: gene associated=Tiso_gene_14998}} |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=annotation}} |
− | {{#set: | + | {{#set: reconstruction source=annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:10, 21 March 2018
Contents
Reaction 3.5.1.27-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- polypeptide_deformylase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Charged-fMET-tRNAs[c] + 1 WATER[c] => 1 L-Methionylaminoacyl-tRNAs[c] + 1 PROTON[c] + 1 FORMATE[c]
- With common name(s):
- 1 an N-formyl-L-methionylaminoacyl-tRNA[c] + 1 H2O[c] => 1 a L-methionylaminoacyl-tRNA[c] + 1 H+[c] + 1 formate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14998
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links