Difference between revisions of "RXN66-579"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLUCONATE GLUCONATE] == * smiles: ** C(O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey=RGH...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-579 RXN66-579] == * direction: ** LEFT-TO-RIGHT * common name: ** myo-inositol-1-phosphate_sy...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-579 RXN66-579] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** myo-inositol-1-phosphate_synthase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/5.5.1.4 EC-5.5.1.4] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[GLC-6-P]][c] '''=>''' 1 [[1-L-MYO-INOSITOL-1-P]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 β-D-glucose 6-phosphate[c] '''=>''' 1 1D-myo-inositol 3-monophosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_7167]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=myo-inositol-1-phosphate_synthase}} | |
− | + | {{#set: ec number=EC-5.5.1.4}} | |
− | + | {{#set: gene associated=Tiso_gene_7167}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-creinhardtii|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:10, 21 March 2018
Contents
Reaction RXN66-579
- direction:
- LEFT-TO-RIGHT
- common name:
- myo-inositol-1-phosphate_synthase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 GLC-6-P[c] => 1 1-L-MYO-INOSITOL-1-P[c]
- With common name(s):
- 1 β-D-glucose 6-phosphate[c] => 1 1D-myo-inositol 3-monophosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7167
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation