Difference between revisions of "Tiso gene 7688"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] == * smiles: ** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O...")
(Created page with "Category:Gene == Gene Tiso_gene_7688 == * Synonym(s): == Reactions associated == * Reaction: TREHALA-RXN ** Source: annotation-in-silico_annotation *** Assignment...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-695 CPD-695] ==
+
== Gene Tiso_gene_7688 ==
* smiles:
+
** C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
* inchi key:
+
** InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L
+
* common name:
+
** gibberellin A53
+
* molecular weight:
+
** 346.422   
+
 
* Synonym(s):
 
* Synonym(s):
** GA53
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN1F-167]]
+
* Reaction: [[TREHALA-RXN]]
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY0-1182]]
 +
* [[PWY0-1466]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=TREHALA-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203620 25203620]
+
{{#set: pathway associated=PWY0-1182|PWY0-1466}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27433 27433]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C06094 C06094]
+
* HMDB : HMDB36895
+
{{#set: smiles=C=C1(C2(O)(CC3(C1)(C([CH]4(C(C)(CCCC(C)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: inchi key=InChIKey=CZEMYYICWZPENF-VOLTXKGXSA-L}}
+
{{#set: common name=gibberellin A53}}
+
{{#set: molecular weight=346.422    }}
+
{{#set: common name=GA53}}
+
{{#set: consumed by=RXN1F-167}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_7688

  • Synonym(s):

Reactions associated

Pathways associated

External links