Difference between revisions of "DIHYDROXY-BUTANONE-P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_11251 == * left end position: ** 405 * transcription direction: ** NEGATIVE * right end position: ** 4108 * centisome position: ** 5.107832...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == * smiles: ** CC(=O)C(O)COP(=O)([O-])[O-] * common...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROXY-BUTANONE-P DIHYDROXY-BUTANONE-P] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)C(O)COP(=O)([O-])[O-] |
− | * | + | * common name: |
− | ** | + | ** 1-deoxy-L-glycero-tetrulose 4-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 182.069 |
* Synonym(s): | * Synonym(s): | ||
+ | ** 3,4-dihydroxy-2-butanone-4-phosphate | ||
+ | ** tetrolose phosphate | ||
+ | ** 3,4-dihydroxy-2-butanone-4-P | ||
+ | ** L-3,4-dihydroxybutan-2-one-4-phosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[DIOHBUTANONEPSYN-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658385 90658385] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10739351.html 10739351] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50606 50606] | ||
+ | * BIGG : db4p | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C15556 C15556] | ||
+ | {{#set: smiles=CC(=O)C(O)COP(=O)([O-])[O-]}} | ||
+ | {{#set: common name=1-deoxy-L-glycero-tetrulose 4-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L}} | ||
+ | {{#set: molecular weight=182.069 }} | ||
+ | {{#set: common name=3,4-dihydroxy-2-butanone-4-phosphate|tetrolose phosphate|3,4-dihydroxy-2-butanone-4-P|L-3,4-dihydroxybutan-2-one-4-phosphate}} | ||
+ | {{#set: produced by=DIOHBUTANONEPSYN-RXN}} |
Latest revision as of 20:10, 21 March 2018
Contents
Metabolite DIHYDROXY-BUTANONE-P
- smiles:
- CC(=O)C(O)COP(=O)([O-])[O-]
- common name:
- 1-deoxy-L-glycero-tetrulose 4-phosphate
- inchi key:
- InChIKey=OKYHYXLCTGGOLM-SCSAIBSYSA-L
- molecular weight:
- 182.069
- Synonym(s):
- 3,4-dihydroxy-2-butanone-4-phosphate
- tetrolose phosphate
- 3,4-dihydroxy-2-butanone-4-P
- L-3,4-dihydroxybutan-2-one-4-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)C(O)COP(=O)([O-])[O-" cannot be used as a page name in this wiki.