Difference between revisions of "Tiso gene 557"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)...")
(Created page with "Category:Gene == Gene Tiso_gene_557 == * right end position: ** 24347 * transcription direction: ** POSITIVE * left end position: ** 22467 * centisome position: ** 70.5932...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17367 CPD-17367] ==
+
== Gene Tiso_gene_557 ==
−
* smiles:
+
* right end position:
−
** CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
** 24347
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JHXLRLHTJYMVBK-DHDHVEHBSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (3R)-hydroxy-adrenoyl-CoA
+
** 22467
−
* molecular weight:
+
* centisome position:
−
** 1094.012    
+
** 70.59322    
 
* Synonym(s):
 
* Synonym(s):
−
** (3R)-hydroxy-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA
 
−
** (3R)--hydroxy-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[RXN-15556]]
−
* [[RXN-16112]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=24347}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193769 72193769]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=22467}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76415 76415]
+
{{#set: centisome position=70.59322   }}
−
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: inchi key=InChIKey=JHXLRLHTJYMVBK-DHDHVEHBSA-J}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: common name=(3R)-hydroxy-adrenoyl-CoA}}
+
−
{{#set: molecular weight=1094.012   }}
+
−
{{#set: common name=(3R)-hydroxy-(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl-CoA|(3R)--hydroxy-(7Z,10Z,13Z,16Z)-docosatetraenoyl-CoA}}
+
−
{{#set: produced by=RXN-16112}}
+

Latest revision as of 20:10, 21 March 2018

Gene Tiso_gene_557

  • right end position:
    • 24347
  • transcription direction:
    • POSITIVE
  • left end position:
    • 22467
  • centisome position:
    • 70.59322
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_557&oldid=46526"