Difference between revisions of "RXN-17876"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DETHIOBIOTIN DETHIOBIOTIN] == * smiles: ** CC1(NC(=O)NC1CCCCCC(=O)[O-]) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17876 RXN-17876] == * direction: ** LEFT-TO-RIGHT * common name: ** methionine_aminopeptidase *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17876 RXN-17876] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** methionine_aminopeptidase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.4.11.18 EC-3.4.11.18] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[L-methionyl-L-seryl-Protein]][c] '''=>''' 1 [[MET]][c] '''+''' 1 [[N-terminal-L-Serine]][c] |
| − | == | + | * With common name(s): |
| − | * [[ | + | ** 1 H2O[c] '''+''' 1 an N-terminal-L-methionyl-L-seryl-[protein][c] '''=>''' 1 L-methionine[c] '''+''' 1 an N-terminal L-seryl-[protein][c] |
| − | == | + | |
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_5715]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[Tiso_gene_4247]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-7800]], Ac/N-end rule pathway: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7800 PWY-7800] | ||
| + | ** '''21''' reactions found over '''21''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-experimental_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=methionine_aminopeptidase}} | |
| − | + | {{#set: ec number=EC-3.4.11.18}} | |
| − | + | {{#set: gene associated=Tiso_gene_5715|Tiso_gene_4247}} | |
| − | + | {{#set: in pathway=PWY-7800}} | |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:10, 21 March 2018
Contents
Reaction RXN-17876
- direction:
- LEFT-TO-RIGHT
- common name:
- methionine_aminopeptidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 L-methionyl-L-seryl-Protein[c] => 1 MET[c] + 1 N-terminal-L-Serine[c]
- With common name(s):
- 1 H2O[c] + 1 an N-terminal-L-methionyl-L-seryl-[protein][c] => 1 L-methionine[c] + 1 an N-terminal L-seryl-[protein][c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_5715
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4247
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
