Difference between revisions of "RXN-15563"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] == * smiles: ** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15563 RXN-15563] == * direction: ** LEFT-TO-RIGHT * Synonym(s): == Reaction Formula == * With...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=10-FORMYL-THF 10-FORMYL-THF] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15563 RXN-15563] ==
* smiles:
+
* direction:
** C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L
+
* common name:
+
** 10-formyl-tetrahydrofolate mono-L-glutamate
+
* molecular weight:
+
** 471.429   
+
 
* Synonym(s):
 
* Synonym(s):
** N10-formyl-tetrahydrofolate mono-L-glutamate
 
** N10-formyl-THF mono-L-glutamate
 
** N10-formyl-H4F mono-L-glutamate
 
** 10-formyl-THF mono-L-glutamate
 
** 10-formyl-H4PteGlu1
 
** N10-formyl-H4PteGlu1
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[FTHFO]]
+
* With identifiers:
* [[MTHFCx]]
+
** 1 [[S-ubiquitinyl-UAP-E1-L-cysteine]][c] '''+''' 1 [[N-terminal-specific-UCP-E2-L-cysteine]][c] '''=>''' 1 [[Ubiquitin-activating-protein-E1-L-cys]][c] '''+''' 1 [[S-ubi-N-term-specific-UCP-E2-L-cysteine]][c]
* [[R04560]]
+
* With common name(s):
== Reaction(s) known to produce the compound ==
+
** 1 an S-ubiquitinyl-[E1 ubiquitin-activating enzyme]-L-cysteine[c] '''+''' 1 an [N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine[c] '''=>''' 1 an [E1 ubiquitin-activating enzyme]-L-cysteine[c] '''+''' 1 an S-ubiquitinyl-[an N-terminal E2 ubiquitin-conjugating enzyme]-L-cysteine[c]
* [[FTHFL]]
+
 
== Reaction(s) of unknown directionality ==
+
== Genes associated with this reaction  ==
* [[FPGFTm]]
+
== Pathways  ==
* [[R01655]]
+
* [[PWY-7511]], protein ubiquitylation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7511 PWY-7511]
* [[FPAIF]]
+
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 2800-34-2
+
{{#set: direction=LEFT-TO-RIGHT}}
* METABOLIGHTS : MTBLC57454
+
{{#set: in pathway=PWY-7511}}
* PUBCHEM:
+
{{#set: reconstruction category=annotation}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878370 46878370]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
* HMDB : HMDB00972
+
{{#set: reconstruction tool=pathwaytools}}
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00234 C00234]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57454 57454]
+
* BIGG : 10fthf
+
{{#set: smiles=C2([CH](CN(C=O)C1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))NC3(C(=O)NC(N)=NC(N2)=3))}}
+
{{#set: inchi key=InChIKey=AUFGTPPARQZWDO-YPMHNXCESA-L}}
+
{{#set: common name=10-formyl-tetrahydrofolate mono-L-glutamate}}
+
{{#set: molecular weight=471.429    }}
+
{{#set: common name=N10-formyl-tetrahydrofolate mono-L-glutamate|N10-formyl-THF mono-L-glutamate|N10-formyl-H4F mono-L-glutamate|10-formyl-THF mono-L-glutamate|10-formyl-H4PteGlu1|N10-formyl-H4PteGlu1}}
+
{{#set: consumed by=FTHFO|MTHFCx|R04560}}
+
{{#set: produced by=FTHFL}}
+
{{#set: reversible reaction associated=FPGFTm|R01655|FPAIF}}
+

Latest revision as of 20:11, 21 March 2018

Reaction RXN-15563

  • direction:
    • LEFT-TO-RIGHT
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Pathways

  • PWY-7511, protein ubiquitylation: PWY-7511
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links