Difference between revisions of "CPD-3801"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1125 RXN-1125] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1....")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * commo...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-1125 RXN-1125] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/1.1.1.195 EC-1.1.1.195]
+
** melibionate
 +
* inchi key:
 +
** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
 +
* molecular weight:
 +
** 357.291   
 
* Synonym(s):
 
* Synonym(s):
 +
** melibionic acid
 +
** 6-O-α-D-galactopyranosyl-D-gluconic acid
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17754]]
** 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[SINAPALDEHYDE]][c] '''=>''' 1 [[SINAPYL-ALCOHOL]][c] '''+''' 1 [[NADP]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
== Reaction(s) of unknown directionality ==
** 1 NADPH[c] '''+''' 1 H+[c] '''+''' 1 sinapaldehyde[c] '''=>''' 1 sinapyl alcohol[c] '''+''' 1 NADP+[c]
+
 
+
== Genes associated with this reaction  ==
+
Genes have been associated with this reaction based on different elements listed below.
+
* [[Tiso_gene_15088]]
+
** [[pantograph]]-[[esiliculosus]]
+
* [[Tiso_gene_16681]]
+
** [[pantograph]]-[[athaliana]]
+
== Pathways  ==
+
* [[PWY-361]], phenylpropanoid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-361 PWY-361]
+
** '''7''' reactions found over '''15''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[orthology]]
+
** Source: [[orthology-athaliana]]
+
*** Tool: [[pantograph]]
+
** Source: [[orthology-esiliculosus]]
+
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
* LIGAND-RXN:
+
* PUBCHEM:
** [http://www.genome.jp/dbget-bin/www_bget?R03918 R03918]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771]
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
{{#set: ec number=EC-1.1.1.195}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299]
{{#set: gene associated=Tiso_gene_15088|Tiso_gene_16681}}
+
{{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}}
{{#set: in pathway=PWY-361}}
+
{{#set: common name=melibionate}}
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}}
{{#set: reconstruction source=orthology-athaliana|orthology-esiliculosus}}
+
{{#set: molecular weight=357.291    }}
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}}
 +
{{#set: consumed by=RXN-17754}}

Latest revision as of 20:11, 21 March 2018

Metabolite CPD-3801

  • smiles:
    • C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
  • common name:
    • melibionate
  • inchi key:
    • InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
  • molecular weight:
    • 357.291
  • Synonym(s):
    • melibionic acid
    • 6-O-α-D-galactopyranosyl-D-gluconic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O" cannot be used as a page name in this wiki.