Difference between revisions of "CPD-703"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_12020 == * left end position: ** 5419 * transcription direction: ** POSITIVE * right end position: ** 5829 * centisome position: ** 73.5977...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] == * smiles: ** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O) * common name: ** 4-nitrobenz...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-703 CPD-703] == |
| − | * | + | * smiles: |
| − | ** | + | ** C(=O)C1(C=CC(=CC=1)[N+]([O-])=O) |
| − | * | + | * common name: |
| − | ** | + | ** 4-nitrobenzaldehyde |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 151.121 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4NBZ | ||
| + | ** p-nitrobenzaldehyde | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN0-5141]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CAS : 555-16-8 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=541 541] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.526.html 526] |
| − | {{#set: | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=66926 66926] | ||
| + | * NCI: | ||
| + | ** [http://cactus.nci.nih.gov/ncidb2.2/?nsc=6103 6103] | ||
| + | {{#set: smiles=C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)}} | ||
| + | {{#set: common name=4-nitrobenzaldehyde}} | ||
| + | {{#set: inchi key=InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N}} | ||
| + | {{#set: molecular weight=151.121 }} | ||
| + | {{#set: common name=4NBZ|p-nitrobenzaldehyde}} | ||
| + | {{#set: consumed by=RXN0-5141}} | ||
Latest revision as of 21:11, 21 March 2018
Contents
Metabolite CPD-703
- smiles:
- C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)
- common name:
- 4-nitrobenzaldehyde
- inchi key:
- InChIKey=BXRFQSNOROATLV-UHFFFAOYSA-N
- molecular weight:
- 151.121
- Synonym(s):
- 4NBZ
- p-nitrobenzaldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)C1(C=CC(=CC=1)[N+]([O-])=O)" cannot be used as a page name in this wiki.
