Difference between revisions of "3-oxo-hexanoyl-ACPs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11715 CPD-11715] == * smiles: ** C(=O)(NCC(=O)[O-])CC1(C=CC=CC=1) * inchi key: ** InChIKey=...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-hexanoyl-ACPs 3-oxo-hexanoyl-ACPs] == * common name: ** a 3-oxo-hexanoyl-[acp] * Synonym(...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-oxo-hexanoyl-ACPs 3-oxo-hexanoyl-ACPs] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 3-oxo-hexanoyl-[acp] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** a 3-oxo-hexanoyl-[acyl-carrier protein] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-9518]] | ||
| + | * [[RXN-14972]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[RXN- | + | * [[RXN-9648]] |
| + | * [[RXN-9516]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 3-oxo-hexanoyl-[acp]}} | |
| − | + | {{#set: common name=a 3-oxo-hexanoyl-[acyl-carrier protein]}} | |
| − | + | {{#set: consumed by=RXN-9518|RXN-14972}} | |
| − | + | {{#set: produced by=RXN-9648|RXN-9516}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | + | ||
| − | {{#set: produced by=RXN- | + | |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite 3-oxo-hexanoyl-ACPs
- common name:
- a 3-oxo-hexanoyl-[acp]
- Synonym(s):
- a 3-oxo-hexanoyl-[acyl-carrier protein]
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a 3-oxo-hexanoyl-[acp" cannot be used as a page name in this wiki.
"a 3-oxo-hexanoyl-[acyl-carrier protein" cannot be used as a page name in this wiki.
