Difference between revisions of "Tiso gene 19373"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] == * smiles: ** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O * inchi...")
(Created page with "Category:Gene == Gene Tiso_gene_19373 == * right end position: ** 1868 * transcription direction: ** POSITIVE * left end position: ** 79 * centisome position: ** 3.323517...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3801 CPD-3801] ==
+
== Gene Tiso_gene_19373 ==
−
* smiles:
+
* right end position:
−
** C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O
+
** 1868
−
* inchi key:
+
* transcription direction:
−
** InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M
+
** POSITIVE
−
* common name:
+
* left end position:
−
** melibionate
+
** 79
−
* molecular weight:
+
* centisome position:
−
** 357.291    
+
** 3.323517    
 
* Synonym(s):
 
* Synonym(s):
−
** melibionic acid
 
−
** 6-O-α-D-galactopyranosyl-D-gluconic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-17754]]
+
* Reaction: [[ADDALT-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[ADENODEAMIN-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 +
* [[PWY-7179]]
 +
* [[SALVADEHYPOX-PWY]]
 +
* [[PWY0-1296]]
 +
* [[PWY-7179-1]]
 +
* [[PWY-6609]]
 +
* [[PWY-6611]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=1868}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202771 25202771]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=79}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75299 75299]
+
{{#set: centisome position=3.323517   }}
−
{{#set: smiles=C(C1(C(C(C(C(O1)OCC(C(C(C(C(=O)[O-])O)O)O)O)O)O)O))O}}
+
{{#set: reaction associated=ADDALT-RXN|ADENODEAMIN-RXN}}
−
{{#set: inchi key=InChIKey=MUUBPEHTAPZMCA-RQPDCMAESA-M}}
+
{{#set: pathway associated=PWY-7179|SALVADEHYPOX-PWY|PWY0-1296|PWY-7179-1|PWY-6609|PWY-6611}}
−
{{#set: common name=melibionate}}
+
−
{{#set: molecular weight=357.291   }}
+
−
{{#set: common name=melibionic acid|6-O-α-D-galactopyranosyl-D-gluconic acid}}
+
−
{{#set: consumed by=RXN-17754}}
+

Latest revision as of 20:11, 21 March 2018

Gene Tiso_gene_19373

  • right end position:
    • 1868
  • transcription direction:
    • POSITIVE
  • left end position:
    • 79
  • centisome position:
    • 3.323517
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_19373&oldid=46624"