Difference between revisions of "PWY-6035"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] == * smiles: ** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14916 CPD-14916] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6035 PWY-6035] ==
−
* smiles:
+
* taxonomic range:
−
** CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
−
* inchi key:
+
−
** InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J
+
 
* common name:
 
* common name:
−
** (R)-3-hydroxyoctanoyl-CoA
+
** 2,3-cis-flavanols biosynthesis
−
* molecular weight:
+
−
** 905.7   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (R)-3-hydroxyoctanoyl-CoA
+
** 2,3-cis-flavan-3-ols biosynthesis
−
** (3R)-3-hydroxyoctanoyl-CoA
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN-14275]]
+
'''3''' reactions found over '''3''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-9723]]
−
* [[RXN-14276]]
+
** 2 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_15272]]
 +
*** [[Tiso_gene_9504]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9724]]
 +
** 2 associated gene(s):
 +
*** [[Tiso_gene_15272]]
 +
*** [[Tiso_gene_9504]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-9725]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_9504]]
 +
*** [[Tiso_gene_15272]]
 +
*** [[Tiso_gene_11016]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-33090}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173319 46173319]
+
{{#set: common name=2,3-cis-flavanols biosynthesis}}
−
* CHEBI:
+
{{#set: common name=2,3-cis-flavan-3-ols biosynthesis}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74279 74279]
+
{{#set: reaction found=3}}
−
* BIGG : 3hocoa
+
{{#set: total reaction=3}}
−
{{#set: smiles=CCCCCC(CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)O}}
+
{{#set: completion rate=100.0}}
−
{{#set: inchi key=InChIKey=ATVGTMKWKDUCMS-JWBYWSJJSA-J}}
+
−
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA}}
+
−
{{#set: molecular weight=905.7    }}
+
−
{{#set: common name=(R)-3-hydroxyoctanoyl-CoA|(3R)-3-hydroxyoctanoyl-CoA}}
+
−
{{#set: consumed by=RXN-14275}}
+
−
{{#set: produced by=RXN-14276}}
+

Latest revision as of 19:06, 21 March 2018

Pathway PWY-6035

  • taxonomic range:
  • common name:
    • 2,3-cis-flavanols biosynthesis
  • Synonym(s):
    • 2,3-cis-flavan-3-ols biosynthesis

Reaction(s) found

3 reactions found over 3 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-6035&oldid=39536"