Difference between revisions of "KDOTRANS-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DPG DPG] == * smiles: ** C(C(O)C(OP(=O)([O-])[O-])=O)OP(=O)([O-])[O-] * inchi key: ** InChIKey=...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KDOTRANS-RXN KDOTRANS-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-deoxy-d-manno-octul...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=KDOTRANS-RXN KDOTRANS-RXN] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 3-deoxy-d-manno-octulosonic-acid_transferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.4.99.12 EC-2.4.99.12] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[1 | + | ** 1 [[LIPID-IV-A]][c] '''+''' 1 [[CMP-KDO]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[KDO-LIPID-IVA]][c] '''+''' 1 [[CMP]][c] |
− | == | + | * With common name(s): |
− | == | + | ** 1 lipid IVA[c] '''+''' 1 CMP-3-deoxy-β-D-manno-octulosonate[c] '''=>''' 1 H+[c] '''+''' 1 α-Kdo-(2→6)-lipid IVA[c] '''+''' 1 CMP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
+ | * Gene: [[Tiso_gene_14463]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | * Gene: [[Tiso_gene_14462]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | == Pathways == | ||
+ | * [[KDOSYN-PWY]], Kdo transfer to lipid IVA I: [http://metacyc.org/META/NEW-IMAGE?object=KDOSYN-PWY KDOSYN-PWY] | ||
+ | ** '''2''' reactions found over '''2''' reactions in the full pathway | ||
+ | * [[PWY-7675]], Kdo transfer to lipid IVA II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7675 PWY-7675] | ||
+ | ** '''1''' reactions found over '''2''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=28066 28066] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04658 R04658] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=3-deoxy-d-manno-octulosonic-acid_transferase}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: ec number=EC-2.4.99.12}} |
− | + | {{#set: gene associated=Tiso_gene_14463|Tiso_gene_14462}} | |
− | + | {{#set: in pathway=KDOSYN-PWY|PWY-7675}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:11, 21 March 2018
Contents
Reaction KDOTRANS-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 3-deoxy-d-manno-octulosonic-acid_transferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 LIPID-IV-A[c] + 1 CMP-KDO[c] => 1 PROTON[c] + 1 KDO-LIPID-IVA[c] + 1 CMP[c]
- With common name(s):
- 1 lipid IVA[c] + 1 CMP-3-deoxy-β-D-manno-octulosonate[c] => 1 H+[c] + 1 α-Kdo-(2→6)-lipid IVA[c] + 1 CMP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14463
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-athaliana
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_14462
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- KDOSYN-PWY, Kdo transfer to lipid IVA I: KDOSYN-PWY
- 2 reactions found over 2 reactions in the full pathway
- PWY-7675, Kdo transfer to lipid IVA II: PWY-7675
- 1 reactions found over 2 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links