Difference between revisions of "RXN-17113"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] == * smiles: ** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] == * direction: ** LEFT-TO-RIGHT * common name: ** acyl-coenzyme_a_oxidase * e...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6224 CPD-6224] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17113 RXN-17113] ==
* smiles:
+
* direction:
** C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M
+
 
* common name:
 
* common name:
** gibberellin A34
+
** acyl-coenzyme_a_oxidase
* molecular weight:
+
* ec number:
** 347.387   
+
** [http://enzyme.expasy.org/EC/1.3.3.6 EC-1.3.3.6]
 
* Synonym(s):
 
* Synonym(s):
** GA34
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
== Reaction(s) known to produce the compound ==
+
* With identifiers:
* [[RXN-6550]]
+
** 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-18491]][c] '''=>''' 1 [[HYDROGEN-PEROXIDE]][c] '''+''' 1 [[CPD-18492]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 oxygen[c] '''+''' 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] '''=>''' 1 hydrogen peroxide[c] '''+''' 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18566]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726]
 +
** '''5''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* LIPID_MAPS : LMPR0104170025
+
{{#set: direction=LEFT-TO-RIGHT}}
* PUBCHEM:
+
{{#set: common name=acyl-coenzyme_a_oxidase}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245079 25245079]
+
{{#set: ec number=EC-1.3.3.6}}
* CHEBI:
+
{{#set: gene associated=Tiso_gene_18566}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29593 29593]
+
{{#set: in pathway=PWY-7726}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C11868 C11868]
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
{{#set: smiles=C=C1(C3(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C(O)2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=IGZIQAJJXGRAJF-OQAXFVLUSA-M}}
+
{{#set: common name=gibberellin A34}}
+
{{#set: molecular weight=347.387    }}
+
{{#set: common name=GA34}}
+
{{#set: produced by=RXN-6550}}
+

Latest revision as of 20:11, 21 March 2018

Reaction RXN-17113

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • acyl-coenzyme_a_oxidase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 oxygen[c] + 1 (6Z,9Z,12Z,15Z,18Z)-tetracosapentaenoyl-CoA[c] => 1 hydrogen peroxide[c] + 1 (2E,6Z,9Z,12Z,15Z,18Z)-tetracosahexaenoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7726, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): PWY-7726
    • 5 reactions found over 13 reactions in the full pathway

Reconstruction information

External links