Difference between revisions of "CPD-4186"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-576 CPD-576] == * common name: ** an N-acyl-L-aspartate * Synonym(s): == Reaction(s) known...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4186 CPD-4186] == |
| + | * smiles: | ||
| + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C | ||
* common name: | * common name: | ||
| − | ** | + | ** lathosterol |
| + | * inchi key: | ||
| + | ** InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N | ||
| + | * molecular weight: | ||
| + | ** 386.66 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 5α-cholest-7-en-3β-ol | ||
| + | ** α-cholest-7-en-3β-ol | ||
| + | ** cholesta-7-enol | ||
| + | ** Δ7-cholesten-3-β-ol | ||
| + | ** γ-cholesterol | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[ | + | * [[1.14.21.6-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | {{#set: common name= | + | * CAS : 80-99-9 |
| − | {{#set: consumed by= | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=65728 65728] | ||
| + | * HMDB : HMDB01170 | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17168 17168] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01189 C01189] | ||
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C}} | ||
| + | {{#set: common name=lathosterol}} | ||
| + | {{#set: inchi key=InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N}} | ||
| + | {{#set: molecular weight=386.66 }} | ||
| + | {{#set: common name=5α-cholest-7-en-3β-ol|α-cholest-7-en-3β-ol|cholesta-7-enol|Δ7-cholesten-3-β-ol|γ-cholesterol}} | ||
| + | {{#set: consumed by=1.14.21.6-RXN}} | ||
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite CPD-4186
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C
- common name:
- lathosterol
- inchi key:
- InChIKey=IZVFFXVYBHFIHY-SKCNUYALSA-N
- molecular weight:
- 386.66
- Synonym(s):
- 5α-cholest-7-en-3β-ol
- α-cholest-7-en-3β-ol
- cholesta-7-enol
- Δ7-cholesten-3-β-ol
- γ-cholesterol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2([CH](CC1)C3(C)([CH](CC=2)CC(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
