Difference between revisions of "RXN-17109"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] == * smiles: ** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17109 RXN-17109] == * direction: ** LEFT-TO-RIGHT * common name: ** chloroplast_beta-keto_acyl_...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6972 CPD-6972] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17109 RXN-17109] ==
* smiles:
+
* direction:
** CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O
+
** LEFT-TO-RIGHT
* inchi key:
+
** InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I
+
 
* common name:
 
* common name:
** 4-(2'-carboxyphenyl)-4-oxobutyryl-CoA
+
** chloroplast_beta-keto_acyl_reductase
* molecular weight:
+
* ec number:
** 966.676   
+
** [http://enzyme.expasy.org/EC/1.1.1.330 EC-1.1.1.330]
 
* Synonym(s):
 
* Synonym(s):
** succinylbenzoyl-CoA
 
** 2-succinylbenzoyl-CoA
 
** 2-(3'-carboxypropionyl)benzoyl-CoA
 
** o-succinylbenzoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[NAPHTHOATE-SYN-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-17329]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[CPD-18489]][c] '''+''' 1 [[NADP]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-oxo-tetracosatetraenoyl-CoA[c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 (3R)-hydroxy-tetracosatetraenoyl-CoA[c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9871]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7726]], (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7726 PWY-7726]
 +
** '''5''' reactions found over '''13''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245100 25245100]
+
{{#set: common name=chloroplast_beta-keto_acyl_reductase}}
* CHEBI:
+
{{#set: ec number=EC-1.1.1.330}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15509 15509]
+
{{#set: gene associated=Tiso_gene_9871}}
* BIGG : sbzcoa
+
{{#set: in pathway=PWY-7726}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C03160 C03160]
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
{{#set: smiles=CC(COP([O-])(=O)OP([O-])(=O)OCC3(C(C(C(N2(C=NC1(C(=NC=NC=12)N)))O3)O)OP([O-])(=O)[O-]))(C)C(C(NCCC(NCCSC(CCC(C4(C=CC=CC(C([O-])=O)=4))=O)=O)=O)=O)O}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=KVAQAPQXOXTRAE-UHFFFAOYSA-I}}
+
{{#set: common name=4-(2'-carboxyphenyl)-4-oxobutyryl-CoA}}
+
{{#set: molecular weight=966.676    }}
+
{{#set: common name=succinylbenzoyl-CoA|2-succinylbenzoyl-CoA|2-(3'-carboxypropionyl)benzoyl-CoA|o-succinylbenzoyl-CoA}}
+
{{#set: consumed by=NAPHTHOATE-SYN-RXN}}
+

Latest revision as of 20:11, 21 March 2018

Reaction RXN-17109

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • chloroplast_beta-keto_acyl_reductase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-oxo-tetracosatetraenoyl-CoA[c] + 1 NADPH[c] + 1 H+[c] => 1 (3R)-hydroxy-tetracosatetraenoyl-CoA[c] + 1 NADP+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7726, (4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoate biosynthesis (6-desaturase): PWY-7726
    • 5 reactions found over 13 reactions in the full pathway

Reconstruction information

External links