Difference between revisions of "Reduced-adrenal-ferredoxins"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-adrenal-ferredoxins Reduced-adrenal-ferredoxins] == * common name: ** a reduced adreno...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-206 CPD-206] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Reduced-adrenal-ferredoxins Reduced-adrenal-ferredoxins] ==
* smiles:
+
** CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
* inchi key:
+
** InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J
+
 
* common name:
 
* common name:
** phytanoyl-CoA
+
** a reduced  adrenodoxin
* molecular weight:
+
** 1058.022   
+
 
* Synonym(s):
 
* Synonym(s):
 +
** a reduced adrenal ferredoxin
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[1.14.11.18-RXN]]
+
* [[RXN-9843]]
 +
* [[RXN-9844]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN66-482]]
 
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a reduced  adrenodoxin}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658363 90658363]
+
{{#set: common name=a reduced adrenal ferredoxin}}
* CHEBI:
+
{{#set: consumed by=RXN-9843|RXN-9844}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15538 15538]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C02060 C02060]
+
* HMDB : HMDB01359
+
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: inchi key=InChIKey=NRJQGHHZMSOUEN-HHVNVSIESA-J}}
+
{{#set: common name=phytanoyl-CoA}}
+
{{#set: molecular weight=1058.022    }}
+
{{#set: consumed by=1.14.11.18-RXN}}
+
{{#set: produced by=RXN66-482}}
+

Latest revision as of 20:11, 21 March 2018

Metabolite Reduced-adrenal-ferredoxins

  • common name:
    • a reduced adrenodoxin
  • Synonym(s):
    • a reduced adrenal ferredoxin

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links