Difference between revisions of "Tiso gene 12321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7025 CPD-7025] == * smiles: ** CC(CCCC(CCCC(C)CCCC(C)=CCOP([O-])(=O)[O-])C)C * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_12321 == * right end position: ** 1964 * transcription direction: ** POSITIVE * left end position: ** 227 * centisome position: ** 3.178381...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12321 == |
− | * | + | * right end position: |
− | ** | + | ** 1964 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 227 |
− | * | + | * centisome position: |
− | ** | + | ** 3.1783814 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[GAMMA-GLUTAMYLTRANSFERASE-RXN]] | |
− | * [[RXN- | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: automated-name-match |
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-18092]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | * Reaction: [[RXN-6601]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN-9157]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[RXN66-336]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: automated-name-match | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY-4041]] | ||
+ | * [[PWY-5826]] | ||
+ | * [[PWY66-375]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=1964}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=227}} | |
− | + | {{#set: centisome position=3.1783814 }} | |
− | {{#set: | + | {{#set: reaction associated=GAMMA-GLUTAMYLTRANSFERASE-RXN|RXN-18092|RXN-6601|RXN-9157|RXN66-336}} |
− | {{#set: | + | {{#set: pathway associated=PWY-4041|PWY-5826|PWY66-375}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:11, 21 March 2018
Gene Tiso_gene_12321
- right end position:
- 1964
- transcription direction:
- POSITIVE
- left end position:
- 227
- centisome position:
- 3.1783814
- Synonym(s):
Reactions associated
- Reaction: GAMMA-GLUTAMYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-18092
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation
- Reaction: RXN-6601
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-9157
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN66-336
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation