Difference between revisions of "BIO-5-AMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MAL MAL] == * smiles: ** C(=O)([O-])CC(O)C([O-])=O * inchi key: ** InChIKey=BJEPYKJPYRNKOW-REOH...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BIO-5-AMP BIO-5-AMP] == |
* smiles: | * smiles: | ||
− | ** C(=O)([O-]) | + | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45)) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** biotinyl-5'-adenylate |
+ | * inchi key: | ||
+ | ** InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 572.509 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** biotinyl-5'-AMP |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN0-7192]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53239798 53239798] |
− | * HMDB : | + | * HMDB : HMDB04220 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62414 62414] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles=C(=O)([O-]) | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05921 C05921] |
− | {{#set: | + | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))}} |
− | {{#set: | + | {{#set: common name=biotinyl-5'-adenylate}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M}} |
− | {{#set: common name= | + | {{#set: molecular weight=572.509 }} |
− | + | {{#set: common name=biotinyl-5'-AMP}} | |
− | {{#set: produced by= | + | {{#set: produced by=RXN0-7192}} |
− | + |
Latest revision as of 20:11, 21 March 2018
Contents
Metabolite BIO-5-AMP
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))
- common name:
- biotinyl-5'-adenylate
- inchi key:
- InChIKey=UTQCSTJVMLODHM-RHCAYAJFSA-M
- molecular weight:
- 572.509
- Synonym(s):
- biotinyl-5'-AMP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP([O-])(=O)OC(=O)CCCCC4(SC[CH]5(NC(=O)N[CH]45))" cannot be used as a page name in this wiki.