Difference between revisions of "MALTODEXGLUCOSID-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-641 CPD-641] == * smiles: ** CC(O)(CCOP(=O)([O-])OP([O-])([O-])=O)CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALTODEXGLUCOSID-RXN MALTODEXGLUCOSID-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** alpha...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MALTODEXGLUCOSID-RXN MALTODEXGLUCOSID-RXN] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** alpha-glucosidase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.2.1.20 EC-3.2.1.20] |
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[WATER]][c] '''+''' 1 [[1-4-alpha-D-Glucan]][c] '''=>''' 1 [[1-4-alpha-D-Glucan]][c] '''+''' 1 [[Glucopyranose]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 a 1,4-α-D-glucan[c] '''=>''' 1 a 1,4-α-D-glucan[c] '''+''' 1 D-glucopyranose[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_600]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | * Gene: [[Tiso_gene_4952]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_4953]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | * Gene: [[Tiso_gene_599]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=alpha-glucosidase}} | |
| − | + | {{#set: ec number=EC-3.2.1.20}} | |
| − | + | {{#set: gene associated=Tiso_gene_600|Tiso_gene_4952|Tiso_gene_4953|Tiso_gene_599}} | |
| − | + | {{#set: in pathway=}} | |
| − | + | {{#set: reconstruction category=orthology|annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation|orthology-esiliculosus}} | |
| − | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:11, 21 March 2018
Contents
Reaction MALTODEXGLUCOSID-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- alpha-glucosidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 1-4-alpha-D-Glucan[c] => 1 1-4-alpha-D-Glucan[c] + 1 Glucopyranose[c]
- With common name(s):
- 1 H2O[c] + 1 a 1,4-α-D-glucan[c] => 1 a 1,4-α-D-glucan[c] + 1 D-glucopyranose[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_600
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_4952
- Source: orthology-esiliculosus
- Gene: Tiso_gene_4953
- Source: orthology-esiliculosus
- Gene: Tiso_gene_599
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
