Difference between revisions of "Cis-cis-D13-25-C44-2-ACPs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-881 CPD-881] == * smiles: ** CC(C=CC1(=C(CCCC1(C)C)C))=CC=CC(=CC=O)C * inchi key: ** InChIK...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D13-25-C44-2-ACPs cis-cis-D13-25-C44-2-ACPs] == * common name: ** a cis,cis-delta13,25-...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-881 CPD-881] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=cis-cis-D13-25-C44-2-ACPs cis-cis-D13-25-C44-2-ACPs] ==
−
* smiles:
+
−
** CC(C=CC1(=C(CCCC1(C)C)C))=CC=CC(=CC=O)C
+
−
* inchi key:
+
−
** InChIKey=NCYCYZXNIZJOKI-IOUUIBBYSA-N
+
 
* common name:
 
* common name:
−
** 11-cis-retinal
+
** a cis,cis-delta13,25-C44:2-[acp]
−
* molecular weight:
+
−
** 284.441   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cis-retinal
 
−
** 11-cis-vitamin A aldehyde
 
−
** 11-cis-retinene
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[RHODOPSINRT]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN1G-337]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 564-87-4
+
{{#set: common name=a cis,cis-delta13,25-C44:2-[acp]}}
−
* LIPID_MAPS : LMPR01090003
+
{{#set: produced by=RXN1G-337}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5280490 5280490]
+
−
* HMDB : HMDB02152
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02110 C02110]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.4444130.html 4444130]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16066 16066]
+
−
* METABOLIGHTS : MTBLC16066
+
−
{{#set: smiles=CC(C=CC1(=C(CCCC1(C)C)C))=CC=CC(=CC=O)C}}
+
−
{{#set: inchi key=InChIKey=NCYCYZXNIZJOKI-IOUUIBBYSA-N}}
+
−
{{#set: common name=11-cis-retinal}}
+
−
{{#set: molecular weight=284.441    }}
+
−
{{#set: common name=cis-retinal|11-cis-vitamin A aldehyde|11-cis-retinene}}
+
−
{{#set: consumed by=RHODOPSINRT}}
+

Latest revision as of 21:12, 21 March 2018

Metabolite cis-cis-D13-25-C44-2-ACPs

  • common name:
    • a cis,cis-delta13,25-C44:2-[acp]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a cis,cis-delta13,25-C44:2-[acp" cannot be used as a page name in this wiki.
Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Cis-cis-D13-25-C44-2-ACPs&oldid=46730"