Difference between revisions of "Tiso gene 1559"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16551 CPD-16551] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Tiso_gene_1559 == * Synonym(s): == Reactions associated == * Reaction: RXN-982 ** Source: orthology-esiliculosus == Pathways associated == *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Gene]] |
| − | == | + | == Gene Tiso_gene_1559 == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | == | + | == Reactions associated == |
| − | * [[RXN- | + | * Reaction: [[RXN-982]] |
| − | == | + | ** Source: [[orthology-esiliculosus]] |
| − | * [[ | + | == Pathways associated == |
| − | + | * [[PWY-4621]] | |
| + | * [[PWY-4202]] | ||
== External links == | == External links == | ||
| − | + | {{#set: reaction associated=RXN-982}} | |
| − | + | {{#set: pathway associated=PWY-4621|PWY-4202}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_1559
- Synonym(s):
Reactions associated
- Reaction: RXN-982
- Source: orthology-esiliculosus
