Difference between revisions of "CYTOSINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=URIDYLYL-PROTEIN-PII URIDYLYL-PROTEIN-PII] == * common name: ** a uridylylated PII protein * Sy...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTOSINE CYTOSINE] == * smiles: ** C1(NC(=O)N=C(N)C=1) * common name: ** cytosine * inchi key:...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTOSINE CYTOSINE] == |
+ | * smiles: | ||
+ | ** C1(NC(=O)N=C(N)C=1) | ||
* common name: | * common name: | ||
− | ** | + | ** cytosine |
+ | * inchi key: | ||
+ | ** InChIKey=OPTASPLRGRRNAP-UHFFFAOYSA-N | ||
+ | * molecular weight: | ||
+ | ** 111.103 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 4-amino-2-oxo-1,2-dihydropyrimidine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[RXN-14065]] |
+ | * [[RXN0-361]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: common name= | + | * CAS : 71-30-7 |
− | {{#set: produced by= | + | * BIGG : csn |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=597 597] | ||
+ | * HMDB : HMDB00630 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00380 C00380] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.577.html 577] | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16040 16040] | ||
+ | * METABOLIGHTS : MTBLC16040 | ||
+ | {{#set: smiles=C1(NC(=O)N=C(N)C=1)}} | ||
+ | {{#set: common name=cytosine}} | ||
+ | {{#set: inchi key=InChIKey=OPTASPLRGRRNAP-UHFFFAOYSA-N}} | ||
+ | {{#set: molecular weight=111.103 }} | ||
+ | {{#set: common name=4-amino-2-oxo-1,2-dihydropyrimidine}} | ||
+ | {{#set: produced by=RXN-14065|RXN0-361}} |
Latest revision as of 21:12, 21 March 2018
Contents
Metabolite CYTOSINE
- smiles:
- C1(NC(=O)N=C(N)C=1)
- common name:
- cytosine
- inchi key:
- InChIKey=OPTASPLRGRRNAP-UHFFFAOYSA-N
- molecular weight:
- 111.103
- Synonym(s):
- 4-amino-2-oxo-1,2-dihydropyrimidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 71-30-7
- BIGG : csn
- PUBCHEM:
- HMDB : HMDB00630
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC16040