Difference between revisions of "SULFOCYS-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] == * smiles: ** C1(=C(C([O-])=O)NC(NC(=O)1)=O) * inchi key: ** InChIKey=PXQPEW...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFOCYS-RXN SULFOCYS-RXN] == * direction: ** REVERSIBLE * common name: ** cog0031:_cysteine_syntha...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OROTATE OROTATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=SULFOCYS-RXN SULFOCYS-RXN] ==
−
* smiles:
+
* direction:
−
** C1(=C(C([O-])=O)NC(NC(=O)1)=O)
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M
+
 
* common name:
 
* common name:
−
** orotate
+
** cog0031:_cysteine_synthase
−
* molecular weight:
+
** cysteine_synthase
−
** 155.09   
+
** cysteine
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.5.1.47 EC-2.5.1.47]
 
* Synonym(s):
 
* Synonym(s):
−
** orotic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-6490]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[S2O3]][c] '''+''' 1 [[ACETYLSERINE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[ACET]][c] '''+''' 1 [[SULFO-CYSTEINE]][c]
−
* [[RXN0-6491]]
+
* With common name(s):
−
* [[RXN0-6554]]
+
** 1 thiosulfate[c] '''+''' 1 O-acetyl-L-serine[c] '''<=>''' 1 H+[c] '''+''' 1 acetate[c] '''+''' 1 S-sulfo-L-cysteine[c]
−
* [[DIHYDROOROTATE-DEHYDROGENASE-RXN]]
+
 
−
* [[RXN-9929]]
+
== Genes associated with this reaction  ==
−
== Reaction(s) of unknown directionality ==
+
Genes have been associated with this reaction based on different elements listed below.
−
* [[OROPRIBTRANS-RXN]]
+
* Gene: [[Tiso_gene_2283]]
−
* [[orPRT]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17043]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_6110]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_3732]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_7852]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_819]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_12184]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 65-86-1
+
* RHEA:
−
* METABOLIGHTS : MTBLC30839
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=30891 30891]
−
* PUBCHEM:
+
* LIGAND-RXN:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1492348 1492348]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03132 R03132]
−
* HMDB : HMDB00226
+
{{#set: direction=REVERSIBLE}}
−
* LIGAND-CPD:
+
{{#set: common name=cog0031:_cysteine_synthase}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00295 C00295]
+
{{#set: common name=cysteine_synthase}}
−
* CHEBI:
+
{{#set: common name=cysteine}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=30839 30839]
+
{{#set: ec number=EC-2.5.1.47}}
−
* BIGG : orot
+
{{#set: gene associated=Tiso_gene_2283|Tiso_gene_17043|Tiso_gene_6110|Tiso_gene_3732|Tiso_gene_7852|Tiso_gene_819|Tiso_gene_12184}}
−
{{#set: smiles=C1(=C(C([O-])=O)NC(NC(=O)1)=O)}}
+
{{#set: in pathway=}}
−
{{#set: inchi key=InChIKey=PXQPEWDEAKTCGB-UHFFFAOYSA-M}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: common name=orotate}}
+
{{#set: reconstruction source=orthology-creinhardtii|annotation-experimental_annotation|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}}
−
{{#set: molecular weight=155.09    }}
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: common name=orotic acid}}
+
−
{{#set: consumed by=RXN0-6490}}
+
−
{{#set: produced by=RXN0-6491|RXN0-6554|DIHYDROOROTATE-DEHYDROGENASE-RXN|RXN-9929}}
+
−
{{#set: reversible reaction associated=OROPRIBTRANS-RXN|orPRT}}
+

Latest revision as of 20:12, 21 March 2018

Reaction SULFOCYS-RXN

  • direction:
    • REVERSIBLE
  • common name:
    • cog0031:_cysteine_synthase
    • cysteine_synthase
    • cysteine
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 thiosulfate[c] + 1 O-acetyl-L-serine[c] <=> 1 H+[c] + 1 acetate[c] + 1 S-sulfo-L-cysteine[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=SULFOCYS-RXN&oldid=46766"