Difference between revisions of "Tiso gene 11635"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GLYCEROL-3P GLYCEROL-3P] == * smiles: ** C(OP([O-])(=O)[O-])C(O)CO * inchi key: ** InChIKey=AWU...") |
(Created page with "Category:Gene == Gene Tiso_gene_11635 == * right end position: ** 4962 * transcription direction: ** POSITIVE * left end position: ** 4192 * centisome position: ** 54.7401...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_11635 == |
− | * | + | * right end position: |
− | ** | + | ** 4962 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 4192 |
− | * | + | * centisome position: |
− | ** | + | ** 54.740143 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[DAPASYN-RXN]] |
− | * | + | ** Source: [[orthology-athaliana]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * | + | ** Source: [[orthology-creinhardtii]] |
− | * [[ | + | * Reaction: [[DETHIOBIOTIN-SYN-RXN]] |
− | * | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: ec-number | |
− | * [[ | + | == Pathways associated == |
− | * [[ | + | * [[PWY0-1507]] |
− | * | + | * [[PWY-7380]] |
− | * [[ | + | |
− | + | ||
− | + | ||
− | * | + | |
− | * | + | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | * [[ | + | |
− | + | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=4962}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=4192}} | |
− | + | {{#set: centisome position=54.740143 }} | |
− | + | {{#set: reaction associated=DAPASYN-RXN|DETHIOBIOTIN-SYN-RXN}} | |
− | + | {{#set: pathway associated=PWY0-1507|PWY-7380}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | {{#set: | + | |
− | + |
Latest revision as of 20:12, 21 March 2018
Gene Tiso_gene_11635
- right end position:
- 4962
- transcription direction:
- POSITIVE
- left end position:
- 4192
- centisome position:
- 54.740143
- Synonym(s):
Reactions associated
- Reaction: DAPASYN-RXN
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Reaction: DETHIOBIOTIN-SYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation