Difference between revisions of "CPD-637"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OBTUSIFOLIOL OBTUSIFOLIOL] == * smiles: ** CC(C)C(=C)CCC(C)[CH]3(CCC4(C)(C2(CC[CH]1(C(C)C(O)CCC...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == * smiles: ** CC1(C(=C(C=CC=1)O)C([O-])=O) * common name: ** 6-methylsalicyl...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-637 CPD-637] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC1(C(=C(C=CC=1)O)C([O-])=O) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 6-methylsalicylate |
+ | * inchi key: | ||
+ | ** InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 151.141 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Methylsalicylic acid |
− | ** | + | ** 6-Methyl 2-hydroxybenzenecarboxylate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[2.3.1.165-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54693536 54693536] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5342108.html 5342108] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=36658 36658] |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02657 C02657] |
− | + | {{#set: smiles=CC1(C(=C(C=CC=1)O)C([O-])=O)}} | |
− | {{#set: smiles= | + | {{#set: common name=6-methylsalicylate}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M}} |
− | {{#set: | + | {{#set: molecular weight=151.141 }} |
− | {{#set: molecular weight= | + | {{#set: common name=Methylsalicylic acid|6-Methyl 2-hydroxybenzenecarboxylate}} |
− | {{#set: common name= | + | {{#set: produced by=2.3.1.165-RXN}} |
− | {{#set: | + | |
− | + |
Latest revision as of 20:12, 21 March 2018
Contents
Metabolite CPD-637
- smiles:
- CC1(C(=C(C=CC=1)O)C([O-])=O)
- common name:
- 6-methylsalicylate
- inchi key:
- InChIKey=HCJMNOSIAGSZBM-UHFFFAOYSA-M
- molecular weight:
- 151.141
- Synonym(s):
- Methylsalicylic acid
- 6-Methyl 2-hydroxybenzenecarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(C(=C(C=CC=1)O)C([O-])=O)" cannot be used as a page name in this wiki.