Difference between revisions of "DGTCY"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] == * smiles: ** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTCY DGTCY] == * direction: ** LEFT-TO-RIGHT * common name: ** dGTP:cytidine 5'-phosphotransferase...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=COBINAMIDE COBINAMIDE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=DGTCY DGTCY] ==
−
* smiles:
+
* direction:
−
** CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M
+
 
* common name:
 
* common name:
−
** cobinamide
+
** dGTP:cytidine 5'-phosphotransferase
−
* molecular weight:
+
−
** 990.096   
+
 
* Synonym(s):
 
* Synonym(s):
−
** Cbi
 
−
** cobyrinic acid a,c-diamide
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[BTUR2-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1.0 [[CYTIDINE]][c] '''+''' 1.0 [[DGTP]][c] '''=>''' 1.0 [[CMP]][c] '''+''' 1.0 [[DGDP]][c] '''+''' 1.0 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 cytidine[c] '''+''' 1.0 dGTP[c] '''=>''' 1.0 CMP[c] '''+''' 1.0 dGDP[c] '''+''' 1.0 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14474]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_20134]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1867-62-5
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=dGTP:cytidine 5'-phosphotransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820010 91820010]
+
{{#set: gene associated=Tiso_gene_14474|Tiso_gene_20134}}
−
* HMDB : HMDB06902
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05774 C05774]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28956 28956]
+
−
* BIGG : cbi
+
−
{{#set: smiles=CC(O)CNC(=O)CCC5(C)(C(CC(=O)N)[CH]7(C8(C)(C(C)(CC(N)=O)C(CCC(N)=O)C1(=[N+]([Co---]26([N+]4(C(=CC3(C(CCC(N)=O)C(C)(CC(N)=O)C(=C(C)1)[N+]2=3))C(C)(C)C(CCC(N)=O)C=4C(C)=C5N67)))8))))}}
+
−
{{#set: inchi key=InChIKey=XQRJFEVDQXEIAX-JFYQDRLCSA-M}}
+
−
{{#set: common name=cobinamide}}
+
−
{{#set: molecular weight=990.096    }}
+
−
{{#set: common name=Cbi|cobyrinic acid a,c-diamide}}
+
−
{{#set: consumed by=BTUR2-RXN}}
+

Latest revision as of 20:12, 21 March 2018

Reaction DGTCY

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • dGTP:cytidine 5'-phosphotransferase
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 cytidine[c] + 1.0 dGTP[c] => 1.0 CMP[c] + 1.0 dGDP[c] + 1.0 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=DGTCY&oldid=46790"